List of usage examples for org.apache.commons.lang3.tuple Pair getRight
public abstract R getRight();
Gets the right element from this pair.
When treated as a key-value pair, this is the value.
From source file:com.teambr.bookshelf.client.gui.component.control.GuiComponentSideSelector.java
/** * Draws the highlights onto the block/*from w w w. ja va2 s .com*/ * @param selections The colors to render */ private void drawHighlights(List<Pair<SidePicker.Side, Color>> selections) { GlStateManager.disableLighting(); GlStateManager.blendFunc(GL11.GL_SRC_ALPHA, GL11.GL_ONE_MINUS_SRC_ALPHA); GlStateManager.enableBlend(); GlStateManager.enableAlpha(); GlStateManager.disableDepth(); GlStateManager.disableTexture2D(); GL11.glBegin(GL11.GL_QUADS); for (Pair<SidePicker.Side, Color> pair : selections) { if (pair.getRight() != null) RenderUtils.setColor(pair.getRight()); switch (pair.getLeft()) { case XPos: GL11.glVertex3d(0.5, -0.5, -0.5); GL11.glVertex3d(0.5, 0.5, -0.5); GL11.glVertex3d(0.5, 0.5, 0.5); GL11.glVertex3d(0.5, -0.5, 0.5); break; case YPos: GL11.glVertex3d(-0.5, 0.5, -0.5); GL11.glVertex3d(-0.5, 0.5, 0.5); GL11.glVertex3d(0.5, 0.5, 0.5); GL11.glVertex3d(0.5, 0.5, -0.5); break; case ZPos: GL11.glVertex3d(-0.5, -0.5, 0.5); GL11.glVertex3d(0.5, -0.5, 0.5); GL11.glVertex3d(0.5, 0.5, 0.5); GL11.glVertex3d(-0.5, 0.5, 0.5); break; case XNeg: GL11.glVertex3d(-0.5, -0.5, -0.5); GL11.glVertex3d(-0.5, -0.5, 0.5); GL11.glVertex3d(-0.5, 0.5, 0.5); GL11.glVertex3d(-0.5, 0.5, -0.5); break; case YNeg: GL11.glVertex3d(-0.5, -0.5, -0.5); GL11.glVertex3d(0.5, -0.5, -0.5); GL11.glVertex3d(0.5, -0.5, 0.5); GL11.glVertex3d(-0.5, -0.5, 0.5); break; case ZNeg: GL11.glVertex3d(-0.5, -0.5, -0.5); GL11.glVertex3d(-0.5, 0.5, -0.5); GL11.glVertex3d(0.5, 0.5, -0.5); GL11.glVertex3d(0.5, -0.5, -0.5); break; default: } } GL11.glEnd(); GlStateManager.disableBlend(); GlStateManager.enableDepth(); GlStateManager.enableTexture2D(); }
From source file:mase.spec.BasicHybridExchangerDunn.java
@Override protected void mergeProcess(EvolutionState state) { List<BehaviourResult>[] mpBehavs = new List[metaPops.size()]; for (int i = 0; i < metaPops.size(); i++) { MetaPopulation mp = metaPops.get(i); Individual[] inds = getElitePortion(mp.inds, (int) Math.ceil(elitePortion * popSize)); mpBehavs[i] = new ArrayList<BehaviourResult>(mp.agents.size() * inds.length); for (Individual ind : inds) { for (Integer a : mp.agents) { mpBehavs[i].add(getAgentBR(ind, a)); }/* www . j av a2s. c o m*/ } } distanceMatrix = distanceMatrix(mpBehavs, state); Pair<MetaPopulation, MetaPopulation> nextMerge = metaPops.size() >= 3 ? findNextMerge(distanceMatrix, state) : null; // Merge if they are similar if (nextMerge != null) { state.output.message("*************************** Merging " + nextMerge.getLeft() + " with " + nextMerge.getRight() + " ***************************"); merges++; MetaPopulation mpNew = mergePopulations(nextMerge.getLeft(), nextMerge.getRight(), state); metaPops.remove(nextMerge.getLeft()); metaPops.remove(nextMerge.getRight()); metaPops.add(mpNew); } }
From source file:com.act.lcms.v2.MassChargeCalculatorTest.java
@Test public void testComputeMass() throws Exception { List<Pair<MassChargeCalculator.MZSource, Double>> testCases = Arrays.asList( Pair.of(new MassChargeCalculator.MZSource( "InChI=1S/C8H9NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5,11H,1H3,(H,9,10)"), 151.063329), Pair.of(new MassChargeCalculator.MZSource(151.063329), 151.063329), Pair.of(new MassChargeCalculator.MZSource(Pair.of("APAP", 151.063329)), 151.063329)); for (Pair<MassChargeCalculator.MZSource, Double> testCase : testCases) { Double actualMass = MassChargeCalculator.computeMass(testCase.getLeft()); assertEquals(//from w w w .j a v a 2 s . com String.format("(Case %d) Actual mass is within bounds: %.6f ~ %.6f", testCase.getLeft().getId(), testCase.getRight(), actualMass), testCase.getRight(), actualMass, MASS_ERROR_TOLERANCE); } }
From source file:edu.uci.ics.hyracks.api.rewriter.runtime.SuperActivityOperatorNodePushable.java
@Override public IFrameWriter getInputFrameWriter(final int index) { /**/* w ww. j a va 2s. com*/ * get the right IFrameWriter from the cluster input index */ Pair<ActivityId, Integer> activityIdInputIndex = parent.getActivityIdInputIndex(index); IOperatorNodePushable operatorNodePushable = operatorNodePushables.get(activityIdInputIndex.getLeft()); IFrameWriter writer = operatorNodePushable.getInputFrameWriter(activityIdInputIndex.getRight()); return writer; }
From source file:de.ks.activity.context.ActivityContext.java
@Override public <T> T get(Contextual<T> contextual) { if (contextual instanceof Bean) { Bean bean = (Bean) contextual;//from www.j a v a2 s . c o m Pair<String, Class<?>> key = getKey(bean); lock.readLock().lock(); try { StoredBean storedBean = activities.get(key.getLeft()).getStoredBean(key.getRight()); if (storedBean != null) { return storedBean.getInstance(); } } finally { lock.readLock().unlock(); } } return null; }
From source file:im.dadoo.cedar.SelectCriteria.java
private String makeConditionSql(Condition condition) { StringBuilder sb = new StringBuilder(); if (condition != null && condition.getField() != null && condition.getOp() != null && condition.getValue() != null) { switch (condition.getOp()) { case EQ:// www . j a v a 2 s .c o m case GT: case LT: sb.append(condition.getField()).append(" ").append(condition.getOp().getWord()).append(" ") .append(condition.getValue()); break; case IN: String temp = null; //?? if (condition.getValue() instanceof String) { temp = (String) condition.getValue(); } else if (condition.getValue() instanceof SelectCriteria) { temp = ((SelectCriteria) condition.getValue()).sql(); } sb.append(condition.getField()).append(" ").append(condition.getOp().getWord()).append(" ") .append("( ").append(temp).append(" )"); break; case BETWEEN: Pair<String, String> pair = (Pair<String, String>) condition.getValue(); sb.append(condition.getField()).append(" ").append(condition.getOp().getWord()).append(" ") .append(pair.getLeft()).append(" ").append("AND").append(" ").append(pair.getRight()); break; } } return sb.toString(); }
From source file:ca.craigthomas.visualclassifier.commandline.TrainCommand.java
public void execute() { NeuralNetwork bestModel = null;// www .j av a 2s. c o m DataSet bestFold = null; double[] tp = new double[arguments.folds]; double[] fp = new double[arguments.folds]; double[] tn = new double[arguments.folds]; double[] fn = new double[arguments.folds]; double[] precision = new double[arguments.folds]; double[] recall = new double[arguments.folds]; double[] f1 = new double[arguments.folds]; double bestF1 = 0; // Step 1: create the dataset if (!arguments.csvFile.isEmpty()) { loadFromCSV(); } else { loadFromDirectories(); } if (mDataSet == null) { LOGGER.log(Level.SEVERE, "no data set could be built, exiting"); return; } // Step 2: Generate layer information List<Integer> layerSizes = new ArrayList<>(); layerSizes.add(mDataSet.getNumColsSamples()); if (arguments.layer1 != 0) { layerSizes.add(arguments.layer1); } if (arguments.layer2 != 0) { layerSizes.add(arguments.layer2); } layerSizes.add(arguments.outputLayer); // Step 3: generate the folds and train the model for (int fold = 0; fold < arguments.folds; fold++) { LOGGER.log(Level.INFO, "processing fold " + (fold + 1)); LOGGER.log(Level.INFO, "randomizing dataset"); mDataSet.randomize(); LOGGER.log(Level.INFO, "generating training and testing sets"); Pair<DataSet, DataSet> split = mDataSet.splitEqually(arguments.split); DataSet trainingData = split.getLeft(); DataSet testingData = split.getRight(); LOGGER.log(Level.INFO, "training neural network..."); trainingData.randomize(); Trainer trainer = new Trainer.Builder(layerSizes, trainingData).maxIterations(arguments.iterations) .heartBeat(arguments.heartBeat).learningRate(arguments.learningRate).lambda(arguments.lambda) .build(); trainer.train(); // Step 4: evaluate each model NeuralNetwork model = trainer.getNeuralNetwork(); Prediction prediction = new Prediction(model, arguments.predictionThreshold); prediction.predict(testingData); System.out.println("True Positives " + prediction.getTruePositives()); System.out.println("False Positives " + prediction.getFalsePositives()); System.out.println("True Negatives " + prediction.getTrueNegatives()); System.out.println("False Negatives " + prediction.getFalseNegatives()); System.out.println("Precision " + prediction.getPrecision()); System.out.println("Recall " + prediction.getRecall()); System.out.println("F1 " + prediction.getF1()); tp[fold] = prediction.getTruePositives(); fp[fold] = prediction.getFalsePositives(); tn[fold] = prediction.getTrueNegatives(); fn[fold] = prediction.getFalseNegatives(); precision[fold] = prediction.getPrecision(); recall[fold] = prediction.getRecall(); f1[fold] = prediction.getF1(); if (f1[fold] > bestF1) { bestModel = model; bestFold = mDataSet.dup(); bestF1 = f1[fold]; } } // Step 6: save the best information to the specified directory if (!arguments.saveDir.isEmpty()) { saveResults(bestModel, bestFold); } // Step 5: compute the overall statistics System.out.println("Overall Statistics"); System.out.println("True Positives " + StatUtils.mean(tp) + " (" + StatUtils.variance(tp) + ")"); System.out.println("False Positives " + StatUtils.mean(fp) + " (" + StatUtils.variance(fp) + ")"); System.out.println("True Negatives " + StatUtils.mean(tn) + " (" + StatUtils.variance(tn) + ")"); System.out.println("False Negatives " + StatUtils.mean(fn) + " (" + StatUtils.variance(fn) + ")"); System.out.println("Precision " + StatUtils.mean(precision) + " (" + StatUtils.variance(precision) + ")"); System.out.println("Recall " + StatUtils.mean(recall) + " (" + StatUtils.variance(recall) + ")"); System.out.println("F1 " + StatUtils.mean(f1) + " (" + StatUtils.variance(f1) + ")"); }
From source file:com.streamsets.pipeline.stage.executor.jdbc.TestJdbcQueryExecutor.java
/** * Validate structure of the result set (column names and types). *///from w ww . j a va2 s. com public void assertResultSetStructure(ResultSet rs, Pair<String, Integer>... columns) throws Exception { ResultSetMetaData metaData = rs.getMetaData(); Assert.assertEquals(Utils.format("Unexpected number of columns"), columns.length, metaData.getColumnCount()); int i = 1; for (Pair<String, Integer> column : columns) { Assert.assertEquals(Utils.format("Unexpected name for column {}", i), column.getLeft(), metaData.getColumnName(i)); Assert.assertEquals(Utils.format("Unexpected type for column {}", i), (int) column.getRight(), metaData.getColumnType(i)); i++; } }
From source file:com.cisco.oss.foundation.message.FoundationQueueConsumerFailureListener.java
@Override public void connectionFailed(HornetQException exception, boolean failedOver) { LOGGER.error("failed connection: {}, failing over: {}", exception, failedOver); if (!failedOver) { boolean done = false; while (!done) { LOGGER.trace("attempting to reconnect to HornetQ"); HornetQMessagingFactory.sessionThreadLocal.set(null); try { // FoundationQueueConsumerFailureListener foundationQueueConsumerFailureListener = new FoundationQueueConsumerFailureListener();; MessageHandler handler = null; if (this.messageHandler == null) { handler = clientConsumer.getMessageHandler(); this.messageHandler = handler; }//from ww w . jav a2 s .co m for (Pair<ClientSession, SessionFailureListener> clientSessionSessionFailureListenerPair : HornetQMessagingFactory .getSession(FoundationQueueConsumerFailureListener.class)) { FoundationQueueConsumerFailureListener foundationQueueConsumerFailureListener = (FoundationQueueConsumerFailureListener) clientSessionSessionFailureListenerPair .getRight(); foundationQueueConsumerFailureListener.setReconnectProperties(queueName, clientConsumer); foundationQueueConsumerFailureListener.setMessageHandler(messageHandler); ClientConsumer consumer = clientSessionSessionFailureListenerPair.getLeft() .createConsumer(queueName); consumer.setMessageHandler(messageHandler); } done = true; } catch (Exception e) { LOGGER.trace("failed to reconnect. retrying...", e); try { Thread.sleep(ConfigurationFactory.getConfiguration() .getInt("service.hornetq.attachRetryDelay", 10000)); } catch (InterruptedException e1) { LOGGER.trace("thread interrupted!!!", e1); } } } } }
From source file:com.jaspersoft.jasperserver.jrsh.completion.completer.RepositoryNameCompleter.java
@Override public int complete(String buffer, int cursor, List<CharSequence> candidates) { if (buffer != null && cursor < buffer.length()) { candidates.add(""); return buffer.length(); }/* w w w . ja va 2 s . c om*/ if (uniqueId == 0) { uniqueId = hashCode(); } if (buffer == null) { candidates.add("/"); return 0; } else { if (uniqueId == hashCode()) { if (buffer.isEmpty()) { return 0; } List<Pair<String, Boolean>> resources; List<String> filteredResources; try { if (isResourceExist(buffer)) { resources = download(buffer); if (!resources.isEmpty() && !buffer.equals("/")) { return buffer.length() + 1; } fillResources(candidates, resources); } else { String root = getPreviousPath(buffer); if (isResourceExist(root)) { resources = download(root); List<Pair<String, Boolean>> temp = new ArrayList<>(); for (Pair<String, Boolean> pair : resources) { String resource = pair.getKey(); Boolean isFolder = pair.getRight(); if (startsWith(resource, buffer)) { ImmutablePair<String, Boolean> newPair = new ImmutablePair<>(resource, isFolder); temp.add(newPair); } } fillResources(candidates, temp); } else { String lastInput = getLastInput(buffer); if ("".equals(lastInput)) { List<Pair<String, Boolean>> temp = new ArrayList<>(); ImmutablePair<String, Boolean> newPair = new ImmutablePair<>("", false); temp.add(newPair); fillResources(candidates, temp); return buffer.length(); } } } } catch (AuthenticationFailedException e3) { SessionUtil.reopenSession(); complete(buffer, cursor, candidates); } if (candidates.size() == 1) { return buffer.lastIndexOf("/") + 1; } if (candidates.size() > 1) { String lastInput = getLastInput(buffer); if (compareCandidatesWithLastInput(lastInput, candidates)) { return buffer.length() - lastInput.length(); } } return buffer.length(); } else { candidates.addAll(bufCandidates); if (candidates.size() > 0) { String lastInput = getLastInput(buffer); if (compareCandidatesWithLastInput(lastInput, candidates)) { return buffer.length() - lastInput.length(); } } return buffer.length(); } } }